C33H52O8SSi — CID 10963264
methyl (1R,2S,4R,5R,8R,11S,12R,13S)-4-[2-(benzenesulfonyl)ethyl]-11-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,3,12-trimethyl-6,14-dioxatetracyclo[10.2.1.05,13.08,13]pentadecane-2-carboxylate (PubChem CID 10963264) has the molecular formula C33H52O8SSi and a molecular weight of 636.92 g/mol. Its IUPAC name is methyl (1R,2S,4R,5R,8R,11S,12R,13S)-4-[2-(benzenesulfonyl)ethyl]-11-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,3,12-trimethyl-6,14-dioxatetracyclo[10.2.1.05,13.08,13]pentadecane-2-carboxylate.
| Compound Name | methyl (1R,2S,4R,5R,8R,11S,12R,13S)-4-[2-(benzenesulfonyl)ethyl]-11-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,3,12-trimethyl-6,14-dioxatetracyclo[10.2.1.05,13.08,13]pentadecane-2-carboxylate |
|---|---|
| PubChem CID | 10963264 |
| Molecular Formula | C33H52O8SSi |
| Molecular Weight | 636.92 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | methyl (1R,2S,4R,5R,8R,11S,12R,13S)-4-[2-(benzenesulfonyl)ethyl]-11-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,3,12-trimethyl-6,14-dioxatetracyclo[10.2.1.05,13.08,13]pentadecane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]4CO[C@](OC)([C@H](CCS(=O)(=O)c5ccccc5)C1(C)C)[C@]43O2 |
| InChI | InChI=1S/C33H52O8SSi/c1-29(2,3)43(9,10)41-26-17-16-22-21-39-33(38-8)25(18-19-42(35,36)23-14-12-11-13-15-23)30(4,5)27(28(34)37-7)24-20-31(26,6)32(22,33)40-24/h11-15,22,24-27H,16-21H2,1-10H3/t22-,24-,25-,26+,27+,31-,32+,33-/m1/s1 |
| InChIKey | XLFIXNVMQAFPIH-MBJIXHDRSA-N |
| XLogP | 6.00 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.92 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|