C32H48O7SSi — CID 11028416
(1S,2R,4S,5R,6S,9R,12R,13R)-15-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-12-methoxy-5,17,17-trimethyl-3,11-dioxapentacyclo[11.3.1.12,5.04,9.04,12]octadecan-16-one (PubChem CID 11028416) has the molecular formula C32H48O7SSi and a molecular weight of 604.88 g/mol. Its IUPAC name is (1S,2R,4S,5R,6S,9R,12R,13R)-15-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-12-methoxy-5,17,17-trimethyl-3,11-dioxapentacyclo[11.3.1.12,5.04,9.04,12]octadecan-16-one.
| Compound Name | (1S,2R,4S,5R,6S,9R,12R,13R)-15-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-12-methoxy-5,17,17-trimethyl-3,11-dioxapentacyclo[11.3.1.12,5.04,9.04,12]octadecan-16-one |
|---|---|
| PubChem CID | 11028416 |
| Molecular Formula | C32H48O7SSi |
| Molecular Weight | 604.88 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | (1S,2R,4S,5R,6S,9R,12R,13R)-15-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-12-methoxy-5,17,17-trimethyl-3,11-dioxapentacyclo[11.3.1.12,5.04,9.04,12]octadecan-16-one |
| SMILES | CO[C@]12OC[C@H]3CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]4(C)C[C@@H](O[C@]314)[C@H]1C(=O)C(S(=O)(=O)c3ccccc3)C[C@@H]2C1(C)C |
| InChI | InChI=1S/C32H48O7SSi/c1-28(2,3)41(8,9)39-25-16-15-20-19-37-32(36-7)24-17-23(40(34,35)21-13-11-10-12-14-21)27(33)26(29(24,4)5)22-18-30(25,6)31(20,32)38-22/h10-14,20,22-26H,15-19H2,1-9H3/t20-,22-,23?,24-,25+,26+,30-,31+,32-/m1/s1 |
| InChIKey | SSGHQMFHJVIYNN-KSPBVWDZSA-N |
| XLogP | 5.78 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.88 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|