C32H59NO5Si2 — CID 10919046
tert-butyl (2S,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(4-phenylmethoxybutyl)pyrrolidine-1-carboxylate (PubChem CID 10919046) has the molecular formula C32H59NO5Si2 and a molecular weight of 594.00 g/mol. Its IUPAC name is tert-butyl (2S,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(4-phenylmethoxybutyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(4-phenylmethoxybutyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10919046 |
| Molecular Formula | C32H59NO5Si2 |
| Molecular Weight | 594.00 g/mol |
| Exact Mass | 593.39 |
| IUPAC Name | tert-butyl (2S,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(4-phenylmethoxybutyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCCCOCc1ccccc1 |
| InChI | InChI=1S/C32H59NO5Si2/c1-30(2,3)36-29(34)33-23-27(37-39(10,11)31(4,5)6)28(38-40(12,13)32(7,8)9)26(33)21-17-18-22-35-24-25-19-15-14-16-20-25/h14-16,19-20,26-28H,17-18,21-24H2,1-13H3/t26-,27-,28-/m0/s1 |
| InChIKey | OTWYFTDHEUHTCJ-KCHLEUMXSA-N |
| XLogP | 8.77 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.00 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|