C34H42NO10P — CID 10919407
benzyl N-[2-[[(2R,3R)-2-[(4-methoxyphenyl)methoxymethyl]-1,4-dioxaspiro[4.4]nonan-3-yl]methoxy-phenylmethoxyphosphoryl]oxyethyl]carbamate (PubChem CID 10919407) has the molecular formula C34H42NO10P and a molecular weight of 655.68 g/mol. Its IUPAC name is benzyl N-[2-[[(2R,3R)-2-[(4-methoxyphenyl)methoxymethyl]-1,4-dioxaspiro[4.4]nonan-3-yl]methoxy-phenylmethoxyphosphoryl]oxyethyl]carbamate.
| Compound Name | benzyl N-[2-[[(2R,3R)-2-[(4-methoxyphenyl)methoxymethyl]-1,4-dioxaspiro[4.4]nonan-3-yl]methoxy-phenylmethoxyphosphoryl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 10919407 |
| Molecular Formula | C34H42NO10P |
| Molecular Weight | 655.68 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | benzyl N-[2-[[(2R,3R)-2-[(4-methoxyphenyl)methoxymethyl]-1,4-dioxaspiro[4.4]nonan-3-yl]methoxy-phenylmethoxyphosphoryl]oxyethyl]carbamate |
| SMILES | COc1ccc(COC[C@H]2OC3(CCCC3)O[C@@H]2COP(=O)(OCCNC(=O)OCc2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H42NO10P/c1-38-30-16-14-29(15-17-30)22-39-25-31-32(45-34(44-31)18-8-9-19-34)26-43-46(37,42-24-28-12-6-3-7-13-28)41-21-20-35-33(36)40-23-27-10-4-2-5-11-27/h2-7,10-17,31-32H,8-9,18-26H2,1H3,(H,35,36)/t31-,32-,46?/m1/s1 |
| InChIKey | HZBATRPHLNJEKG-QAPQHVHKSA-N |
| XLogP | 6.55 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.68 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|