C37H45IN2O7Si — CID 10919838
3-O,4-O-dibenzyl 2-O-tert-butyl (2S,3aR,8bR)-8b-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate (PubChem CID 10919838) has the molecular formula C37H45IN2O7Si and a molecular weight of 784.76 g/mol. Its IUPAC name is 3-O,4-O-dibenzyl 2-O-tert-butyl (2S,3aR,8bR)-8b-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate.
| Compound Name | 3-O,4-O-dibenzyl 2-O-tert-butyl (2S,3aR,8bR)-8b-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 10919838 |
| Molecular Formula | C37H45IN2O7Si |
| Molecular Weight | 784.76 g/mol |
| Exact Mass | 784.20 |
| IUPAC Name | 3-O,4-O-dibenzyl 2-O-tert-butyl (2S,3aR,8bR)-8b-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@]2(O[Si](C)(C)C(C)(C)C)c3cc(I)ccc3N(C(=O)OCc3ccccc3)[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H45IN2O7Si/c1-35(2,3)46-31(41)30-22-37(47-48(7,8)36(4,5)6)28-21-27(38)19-20-29(28)39(33(42)44-23-25-15-11-9-12-16-25)32(37)40(30)34(43)45-24-26-17-13-10-14-18-26/h9-21,30,32H,22-24H2,1-8H3/t30-,32-,37+/m0/s1 |
| InChIKey | TYMWLYZCCYTQSD-JGADYYLWSA-N |
| XLogP | 8.74 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.76 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|