C20H26N2O7 — CID 20748905
1-O-benzyl 5-O-tert-butyl 3-(2-ethoxy-2-oxoethyl)-2-oxoimidazolidine-1,5-dicarboxylate (PubChem CID 20748905) has the molecular formula C20H26N2O7 and a molecular weight of 406.44 g/mol. Its IUPAC name is 1-O-benzyl 5-O-tert-butyl 3-(2-ethoxy-2-oxoethyl)-2-oxoimidazolidine-1,5-dicarboxylate.
| Compound Name | 1-O-benzyl 5-O-tert-butyl 3-(2-ethoxy-2-oxoethyl)-2-oxoimidazolidine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 20748905 |
| Molecular Formula | C20H26N2O7 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1-O-benzyl 5-O-tert-butyl 3-(2-ethoxy-2-oxoethyl)-2-oxoimidazolidine-1,5-dicarboxylate |
| SMILES | CCOC(=O)CN1CC(C(=O)OC(C)(C)C)N(C(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C20H26N2O7/c1-5-27-16(23)12-21-11-15(17(24)29-20(2,3)4)22(18(21)25)19(26)28-13-14-9-7-6-8-10-14/h6-10,15H,5,11-13H2,1-4H3 |
| InChIKey | PGMSBAQRTUMHPI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|