C15H22O — CID 10921983
(4E)-5,9-dimethyl-3-prop-2-enoxydeca-4,8-dien-1-yne (PubChem CID 10921983) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (4E)-5,9-dimethyl-3-prop-2-enoxydeca-4,8-dien-1-yne.
| Compound Name | (4E)-5,9-dimethyl-3-prop-2-enoxydeca-4,8-dien-1-yne |
|---|---|
| PubChem CID | 10921983 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (4E)-5,9-dimethyl-3-prop-2-enoxydeca-4,8-dien-1-yne |
| SMILES | C#CC(/C=C(\C)CCC=C(C)C)OCC=C |
| InChI | InChI=1S/C15H22O/c1-6-11-16-15(7-2)12-14(5)10-8-9-13(3)4/h2,6,9,12,15H,1,8,10-11H2,3-5H3/b14-12+ |
| InChIKey | HJUIWVPVGGKGFK-WYMLVPIESA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|