C3Cl5NO — CID 10922755
1,1,1,2,2-pentachloro-2-isocyanatoethane (PubChem CID 10922755) has the molecular formula C3Cl5NO and a molecular weight of 243.30 g/mol. Its IUPAC name is 1,1,1,2,2-pentachloro-2-isocyanatoethane.
| Compound Name | 1,1,1,2,2-pentachloro-2-isocyanatoethane |
|---|---|
| PubChem CID | 10922755 |
| Molecular Formula | C3Cl5NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 240.84 |
| IUPAC Name | 1,1,1,2,2-pentachloro-2-isocyanatoethane |
| SMILES | O=C=NC(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C3Cl5NO/c4-2(5,6)3(7,8)9-1-10 |
| InChIKey | NOCUWRRNSMGKCX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|