C8H6N4O4S — CID 54050968
1-(1,1-diisocyanatoethylsulfanyl)-1,1-diisocyanatoethane (PubChem CID 54050968) has the molecular formula C8H6N4O4S and a molecular weight of 254.23 g/mol. Its IUPAC name is 1-(1,1-diisocyanatoethylsulfanyl)-1,1-diisocyanatoethane.
| Compound Name | 1-(1,1-diisocyanatoethylsulfanyl)-1,1-diisocyanatoethane |
|---|---|
| PubChem CID | 54050968 |
| Molecular Formula | C8H6N4O4S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 1-(1,1-diisocyanatoethylsulfanyl)-1,1-diisocyanatoethane |
| SMILES | CC(N=C=O)(N=C=O)SC(C)(N=C=O)N=C=O |
| InChI | InChI=1S/C8H6N4O4S/c1-7(9-3-13,10-4-14)17-8(2,11-5-15)12-6-16/h1-2H3 |
| InChIKey | LSVIAVSMVBILSI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|