C21H38N2O2 — CID 20528071
3,5-ditert-butyl-3,5-diisocyanato-2,2,6,6-tetramethylheptane (PubChem CID 20528071) has the molecular formula C21H38N2O2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 3,5-ditert-butyl-3,5-diisocyanato-2,2,6,6-tetramethylheptane.
| Compound Name | 3,5-ditert-butyl-3,5-diisocyanato-2,2,6,6-tetramethylheptane |
|---|---|
| PubChem CID | 20528071 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | 3,5-ditert-butyl-3,5-diisocyanato-2,2,6,6-tetramethylheptane |
| SMILES | CC(C)(C)C(CC(N=C=O)(C(C)(C)C)C(C)(C)C)(N=C=O)C(C)(C)C |
| InChI | InChI=1S/C21H38N2O2/c1-16(2,3)20(22-14-24,17(4,5)6)13-21(23-15-25,18(7,8)9)19(10,11)12/h13H2,1-12H3 |
| InChIKey | BPVRJPPHRZJLEJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|