C17H32O2 — CID 10923558
(2S,3R)-3-but-3-enyl-5-butoxy-2-pentyloxolane (PubChem CID 10923558) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (2S,3R)-3-but-3-enyl-5-butoxy-2-pentyloxolane.
| Compound Name | (2S,3R)-3-but-3-enyl-5-butoxy-2-pentyloxolane |
|---|---|
| PubChem CID | 10923558 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (2S,3R)-3-but-3-enyl-5-butoxy-2-pentyloxolane |
| SMILES | C=CCC[C@@H]1CC(OCCCC)O[C@H]1CCCCC |
| InChI | InChI=1S/C17H32O2/c1-4-7-10-12-16-15(11-8-5-2)14-17(19-16)18-13-9-6-3/h5,15-17H,2,4,6-14H2,1,3H3/t15-,16+,17?/m1/s1 |
| InChIKey | AEEBDONTULVUBO-GARXDOFDSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|