C20H40O3Si — CID 11222033
[(2S)-3-[(2S,3S)-5-butoxy-3-ethenyloxolan-2-yl]-2-methylpropoxy]-tert-butyl-dimethylsilane (PubChem CID 11222033) has the molecular formula C20H40O3Si and a molecular weight of 356.62 g/mol. Its IUPAC name is [(2S)-3-[(2S,3S)-5-butoxy-3-ethenyloxolan-2-yl]-2-methylpropoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2S)-3-[(2S,3S)-5-butoxy-3-ethenyloxolan-2-yl]-2-methylpropoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11222033 |
| Molecular Formula | C20H40O3Si |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | [(2S)-3-[(2S,3S)-5-butoxy-3-ethenyloxolan-2-yl]-2-methylpropoxy]-tert-butyl-dimethylsilane |
| SMILES | C=C[C@@H]1CC(OCCCC)O[C@H]1C[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O3Si/c1-9-11-12-21-19-14-17(10-2)18(23-19)13-16(3)15-22-24(7,8)20(4,5)6/h10,16-19H,2,9,11-15H2,1,3-8H3/t16-,17+,18-,19?/m0/s1 |
| InChIKey | TZDFQYILBDAEOV-TUVJXNFZSA-N |
| XLogP | 5.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|