C18H29NO2 — CID 10924276
2-(1-adamantyl)propan-2-yl (2S)-pyrrolidine-2-carboxylate (PubChem CID 10924276) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl (2S)-pyrrolidine-2-carboxylate.
| Compound Name | 2-(1-adamantyl)propan-2-yl (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10924276 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl (2S)-pyrrolidine-2-carboxylate |
| SMILES | CC(C)(OC(=O)[C@@H]1CCCN1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H29NO2/c1-17(2,21-16(20)15-4-3-5-19-15)18-9-12-6-13(10-18)8-14(7-12)11-18/h12-15,19H,3-11H2,1-2H3/t12?,13?,14?,15-,18?/m0/s1 |
| InChIKey | MTOQZKCOTFHIKI-URZJAHPPSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |