C17H24O4 — CID 10924301
[(E,1R)-1-[(2R,3R,5Z,8R)-2-ethyl-3-hydroxy-3,4,7,8-tetrahydro-2H-oxocin-8-yl]hex-3-en-5-ynyl] acetate (PubChem CID 10924301) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(E,1R)-1-[(2R,3R,5Z,8R)-2-ethyl-3-hydroxy-3,4,7,8-tetrahydro-2H-oxocin-8-yl]hex-3-en-5-ynyl] acetate.
| Compound Name | [(E,1R)-1-[(2R,3R,5Z,8R)-2-ethyl-3-hydroxy-3,4,7,8-tetrahydro-2H-oxocin-8-yl]hex-3-en-5-ynyl] acetate |
|---|---|
| PubChem CID | 10924301 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(E,1R)-1-[(2R,3R,5Z,8R)-2-ethyl-3-hydroxy-3,4,7,8-tetrahydro-2H-oxocin-8-yl]hex-3-en-5-ynyl] acetate |
| SMILES | C#C/C=C/C[C@@H](OC(C)=O)[C@H]1C/C=C\C[C@@H](O)[C@@H](CC)O1 |
| InChI | InChI=1S/C17H24O4/c1-4-6-7-11-16(20-13(3)18)17-12-9-8-10-14(19)15(5-2)21-17/h1,6-9,14-17,19H,5,10-12H2,2-3H3/b7-6+,9-8-/t14-,15-,16-,17-/m1/s1 |
| InChIKey | ULOVTBFQYHQBJU-JFDMBRQASA-N |
| XLogP | 2.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|