C14H23NO7 — CID 10925163
[[(3aR,4S,6R,7R,7aS)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-acetylamino] acetate (PubChem CID 10925163) has the molecular formula C14H23NO7 and a molecular weight of 317.34 g/mol. Its IUPAC name is [[(3aR,4S,6R,7R,7aS)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-acetylamino] acetate.
| Compound Name | [[(3aR,4S,6R,7R,7aS)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-acetylamino] acetate |
|---|---|
| PubChem CID | 10925163 |
| Molecular Formula | C14H23NO7 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | [[(3aR,4S,6R,7R,7aS)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-acetylamino] acetate |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](N(OC(C)=O)C(C)=O)[C@@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H23NO7/c1-7-10(15(8(2)16)22-9(3)17)11-12(13(18-6)19-7)21-14(4,5)20-11/h7,10-13H,1-6H3/t7-,10-,11+,12-,13+/m1/s1 |
| InChIKey | UWRVSLLVRKTGMQ-HCLZXYDTSA-N |
| XLogP | 0.59 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|