C15H19NO9S — CID 10023222
[(3aR,4R,7R,7aS)-1-acetyl-6,7-diacetyloxy-2-sulfanylidene-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazol-4-yl]methyl acetate (PubChem CID 10023222) has the molecular formula C15H19NO9S and a molecular weight of 389.38 g/mol. Its IUPAC name is [(3aR,4R,7R,7aS)-1-acetyl-6,7-diacetyloxy-2-sulfanylidene-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazol-4-yl]methyl acetate.
| Compound Name | [(3aR,4R,7R,7aS)-1-acetyl-6,7-diacetyloxy-2-sulfanylidene-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazol-4-yl]methyl acetate |
|---|---|
| PubChem CID | 10023222 |
| Molecular Formula | C15H19NO9S |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | [(3aR,4R,7R,7aS)-1-acetyl-6,7-diacetyloxy-2-sulfanylidene-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazol-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OC(C)=O)[C@H](OC(C)=O)[C@@H]2[C@H]1OC(=S)N2C(C)=O |
| InChI | InChI=1S/C15H19NO9S/c1-6(17)16-11-12(25-15(16)26)10(5-21-7(2)18)24-14(23-9(4)20)13(11)22-8(3)19/h10-14H,5H2,1-4H3/t10-,11+,12+,13-,14?/m1/s1 |
| InChIKey | HWWUSZNFJGZEFW-RRYROLNDSA-N |
| XLogP | -0.33 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|