C14H19NO7S — CID 10427657
[(1S,2R,6R,8S,9R)-12-acetyl-4,4-dimethyl-11-sulfanylidene-3,5,7,10-tetraoxa-12-azatricyclo[6.4.0.02,6]dodecan-9-yl]methyl acetate (PubChem CID 10427657) has the molecular formula C14H19NO7S and a molecular weight of 345.37 g/mol. Its IUPAC name is [(1S,2R,6R,8S,9R)-12-acetyl-4,4-dimethyl-11-sulfanylidene-3,5,7,10-tetraoxa-12-azatricyclo[6.4.0.02,6]dodecan-9-yl]methyl acetate.
| Compound Name | [(1S,2R,6R,8S,9R)-12-acetyl-4,4-dimethyl-11-sulfanylidene-3,5,7,10-tetraoxa-12-azatricyclo[6.4.0.02,6]dodecan-9-yl]methyl acetate |
|---|---|
| PubChem CID | 10427657 |
| Molecular Formula | C14H19NO7S |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [(1S,2R,6R,8S,9R)-12-acetyl-4,4-dimethyl-11-sulfanylidene-3,5,7,10-tetraoxa-12-azatricyclo[6.4.0.02,6]dodecan-9-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(=S)N(C(C)=O)[C@@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C14H19NO7S/c1-6(16)15-9-10(8(19-13(15)23)5-18-7(2)17)20-12-11(9)21-14(3,4)22-12/h8-12H,5H2,1-4H3/t8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | TUHYACVEVKLHEQ-IYKVGLELSA-N |
| XLogP | 0.33 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|