C18H26O5 — CID 10925319
ethyl (1R,4S)-3-[2-(oxan-2-yloxy)ethoxymethyl]bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate (PubChem CID 10925319) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is ethyl (1R,4S)-3-[2-(oxan-2-yloxy)ethoxymethyl]bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate.
| Compound Name | ethyl (1R,4S)-3-[2-(oxan-2-yloxy)ethoxymethyl]bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
|---|---|
| PubChem CID | 10925319 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | ethyl (1R,4S)-3-[2-(oxan-2-yloxy)ethoxymethyl]bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(COCCOC2CCCCO2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C18H26O5/c1-2-21-18(19)17-14-7-6-13(11-14)15(17)12-20-9-10-23-16-5-3-4-8-22-16/h6-7,13-14,16H,2-5,8-12H2,1H3/t13-,14+,16?/m1/s1 |
| InChIKey | UFWPIPWVMKAQGK-CNYCQXTOSA-N |
| XLogP | 2.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|