C16H22Cl2O3 — CID 10925634
[(Z)-7-(2,2-dichlorocyclopropyl)hept-6-en-2-yl] 4-oxohex-5-enoate (PubChem CID 10925634) has the molecular formula C16H22Cl2O3 and a molecular weight of 333.26 g/mol. Its IUPAC name is [(Z)-7-(2,2-dichlorocyclopropyl)hept-6-en-2-yl] 4-oxohex-5-enoate.
| Compound Name | [(Z)-7-(2,2-dichlorocyclopropyl)hept-6-en-2-yl] 4-oxohex-5-enoate |
|---|---|
| PubChem CID | 10925634 |
| Molecular Formula | C16H22Cl2O3 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [(Z)-7-(2,2-dichlorocyclopropyl)hept-6-en-2-yl] 4-oxohex-5-enoate |
| SMILES | C=CC(=O)CCC(=O)OC(C)CCC/C=C\C1CC1(Cl)Cl |
| InChI | InChI=1S/C16H22Cl2O3/c1-3-14(19)9-10-15(20)21-12(2)7-5-4-6-8-13-11-16(13,17)18/h3,6,8,12-13H,1,4-5,7,9-11H2,2H3/b8-6- |
| InChIKey | SQBIPUMGFOKBHL-VURMDHGXSA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|