C15H25ClO2 — CID 143814921
[(E,2R)-8-[(1S,3R)-3-chlorocyclopentyl]oct-7-en-2-yl] acetate (PubChem CID 143814921) has the molecular formula C15H25ClO2 and a molecular weight of 272.82 g/mol. Its IUPAC name is [(E,2R)-8-[(1S,3R)-3-chlorocyclopentyl]oct-7-en-2-yl] acetate.
| Compound Name | [(E,2R)-8-[(1S,3R)-3-chlorocyclopentyl]oct-7-en-2-yl] acetate |
|---|---|
| PubChem CID | 143814921 |
| Molecular Formula | C15H25ClO2 |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | [(E,2R)-8-[(1S,3R)-3-chlorocyclopentyl]oct-7-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H](C)CCCC/C=C/[C@H]1CC[C@@H](Cl)C1 |
| InChI | InChI=1S/C15H25ClO2/c1-12(18-13(2)17)7-5-3-4-6-8-14-9-10-15(16)11-14/h6,8,12,14-15H,3-5,7,9-11H2,1-2H3/b8-6+/t12-,14+,15-/m1/s1 |
| InChIKey | FPASFHJSIFVPEN-ALROKQHHSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|