C13H14FeO7 — CID 10925775
carbon monoxide;dimethyl 2-[(1E)-3-methylbuta-1,3-dienyl]propanedioate;iron (PubChem CID 10925775) has the molecular formula C13H14FeO7 and a molecular weight of 338.09 g/mol. Its IUPAC name is carbon monoxide;dimethyl 2-[(1E)-3-methylbuta-1,3-dienyl]propanedioate;iron.
| Compound Name | carbon monoxide;dimethyl 2-[(1E)-3-methylbuta-1,3-dienyl]propanedioate;iron |
|---|---|
| PubChem CID | 10925775 |
| Molecular Formula | C13H14FeO7 |
| Molecular Weight | 338.09 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | carbon monoxide;dimethyl 2-[(1E)-3-methylbuta-1,3-dienyl]propanedioate;iron |
| SMILES | C=C(C)/C=C/C(C(=O)OC)C(=O)OC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C10H14O4.3CO.Fe/c1-7(2)5-6-8(9(11)13-3)10(12)14-4;3*1-2;/h5-6,8H,1H2,2-4H3;;;;/b6-5+;;;; |
| InChIKey | ZVJHFEYCJDOKAH-WPYDVODASA-N |
| XLogP | 0.97 |
| TPSA | 112.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.09 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|