C20H10N2O5 — CID 10926420
6,19-dihydroxy-13-oxa-3,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 10926420) has the molecular formula C20H10N2O5 and a molecular weight of 358.31 g/mol. Its IUPAC name is 6,19-dihydroxy-13-oxa-3,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | 6,19-dihydroxy-13-oxa-3,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 10926420 |
| Molecular Formula | C20H10N2O5 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 6,19-dihydroxy-13-oxa-3,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | O=C1OC(=O)c2c1c1c3ccc(O)cc3[nH]c1c1[nH]c3ccc(O)cc3c21 |
| InChI | InChI=1S/C20H10N2O5/c23-7-2-4-11-10(5-7)14-16-15(19(25)27-20(16)26)13-9-3-1-8(24)6-12(9)22-17(13)18(14)21-11/h1-6,21-24H |
| InChIKey | ILNKNYUQONGQIC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|