C19H34BNO5 — CID 10926675
tert-butyl (4R)-2,2-dimethyl-4-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 10926675) has the molecular formula C19H34BNO5 and a molecular weight of 367.30 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10926675 |
| Molecular Formula | C19H34BNO5 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@H]2C[C@@H]2B2OC(C)(C)C(C)(C)O2)COC1(C)C |
| InChI | InChI=1S/C19H34BNO5/c1-16(2,3)24-15(22)21-14(11-23-19(21,8)9)12-10-13(12)20-25-17(4,5)18(6,7)26-20/h12-14H,10-11H2,1-9H3/t12-,13-,14-/m0/s1 |
| InChIKey | KJBBHFYAACDBFZ-IHRRRGAJSA-N |
| XLogP | 3.84 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|