C43H50BNO7 — CID 101336091
tert-butyl (4R)-4-[(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 101336091) has the molecular formula C43H50BNO7 and a molecular weight of 703.69 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101336091 |
| Molecular Formula | C43H50BNO7 |
| Molecular Weight | 703.69 g/mol |
| Exact Mass | 703.37 |
| IUPAC Name | tert-butyl (4R)-4-[(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1OB([C@H]2C[C@H]2[C@@H]2COC(C)(C)N2C(=O)OC(C)(C)C)O[C@H]1C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H50BNO7/c1-40(2,3)50-39(46)45-36(29-49-41(45,4)5)34-28-35(34)44-51-37(42(47-6,30-20-12-8-13-21-30)31-22-14-9-15-23-31)38(52-44)43(48-7,32-24-16-10-17-25-32)33-26-18-11-19-27-33/h8-27,34-38H,28-29H2,1-7H3/t34-,35+,36+,37-,38-/m1/s1 |
| InChIKey | YFLCSIHQHYPSIZ-XGQCJEBPSA-N |
| XLogP | 8.20 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.69 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|