C36H37BO5 — CID 10769209
(E)-3-[(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]prop-2-en-1-ol (PubChem CID 10769209) has the molecular formula C36H37BO5 and a molecular weight of 560.50 g/mol. Its IUPAC name is (E)-3-[(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 10769209 |
| Molecular Formula | C36H37BO5 |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | (E)-3-[(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]prop-2-en-1-ol |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1OB([C@H]2C[C@H]2/C=C/CO)O[C@H]1C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H37BO5/c1-39-35(28-17-7-3-8-18-28,29-19-9-4-10-20-29)33-34(42-37(41-33)32-26-27(32)16-15-25-38)36(40-2,30-21-11-5-12-22-30)31-23-13-6-14-24-31/h3-24,27,32-34,38H,25-26H2,1-2H3/b16-15+/t27-,32+,33-,34-/m1/s1 |
| InChIKey | DXIMPWCGTKBQMA-OPTHFPJUSA-N |
| XLogP | 6.38 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|