C33H32BIO4 — CID 101481542
(4R,5R)-2-[(1S,2S)-2-iodocyclopropyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane (PubChem CID 101481542) has the molecular formula C33H32BIO4 and a molecular weight of 630.33 g/mol. Its IUPAC name is (4R,5R)-2-[(1S,2S)-2-iodocyclopropyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-2-[(1S,2S)-2-iodocyclopropyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101481542 |
| Molecular Formula | C33H32BIO4 |
| Molecular Weight | 630.33 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | (4R,5R)-2-[(1S,2S)-2-iodocyclopropyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1OB([C@H]2C[C@@H]2I)O[C@H]1C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H32BIO4/c1-36-32(24-15-7-3-8-16-24,25-17-9-4-10-18-25)30-31(39-34(38-30)28-23-29(28)35)33(37-2,26-19-11-5-12-20-26)27-21-13-6-14-22-27/h3-22,28-31H,23H2,1-2H3/t28-,29-,30+,31+/m0/s1 |
| InChIKey | YWOLYPPXRFUFSG-SYQUUIDJSA-N |
| XLogP | 7.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.33 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|