C51H55BO5Si — CID 15488684
[(E)-5-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]pent-4-enoxy]-tert-butyl-diphenylsilane (PubChem CID 15488684) has the molecular formula C51H55BO5Si and a molecular weight of 786.89 g/mol. Its IUPAC name is [(E)-5-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]pent-4-enoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(E)-5-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]pent-4-enoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 15488684 |
| Molecular Formula | C51H55BO5Si |
| Molecular Weight | 786.89 g/mol |
| Exact Mass | 786.39 |
| IUPAC Name | [(E)-5-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]pent-4-enoxy]-tert-butyl-diphenylsilane |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1OB(/C=C/CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H55BO5Si/c1-49(2,3)58(45-35-21-10-22-36-45,46-37-23-11-24-38-46)55-40-26-12-25-39-52-56-47(50(53-4,41-27-13-6-14-28-41)42-29-15-7-16-30-42)48(57-52)51(54-5,43-31-17-8-18-32-43)44-33-19-9-20-34-44/h6-11,13-25,27-39,47-48H,12,26,40H2,1-5H3/b39-25+/t47-,48-/m1/s1 |
| InChIKey | SUZUUUHGILUVDD-JLORCWQJSA-N |
| XLogP | 9.89 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.89 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|