C34H35BO5 — CID 10530352
[(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]methanol (PubChem CID 10530352) has the molecular formula C34H35BO5 and a molecular weight of 534.46 g/mol. Its IUPAC name is [(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]methanol.
| Compound Name | [(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 10530352 |
| Molecular Formula | C34H35BO5 |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | [(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]methanol |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1OB([C@H]2C[C@H]2CO)O[C@H]1C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H35BO5/c1-37-33(26-15-7-3-8-16-26,27-17-9-4-10-18-27)31-32(40-35(39-31)30-23-25(30)24-36)34(38-2,28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-22,25,30-32,36H,23-24H2,1-2H3/t25-,30-,31+,32+/m0/s1 |
| InChIKey | OQFUWDAUXJPPRX-SPJMRJSYSA-N |
| XLogP | 5.82 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|