C40H49BO5Si — CID 10651828
[(1S,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10651828) has the molecular formula C40H49BO5Si and a molecular weight of 648.73 g/mol. Its IUPAC name is [(1S,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10651828 |
| Molecular Formula | C40H49BO5Si |
| Molecular Weight | 648.73 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | [(1S,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]methoxy-tert-butyl-dimethylsilane |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1OB([C@H]2C[C@@H]2CO[Si](C)(C)C(C)(C)C)O[C@H]1C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H49BO5Si/c1-38(2,3)47(6,7)44-29-30-28-35(30)41-45-36(39(42-4,31-20-12-8-13-21-31)32-22-14-9-15-23-32)37(46-41)40(43-5,33-24-16-10-17-25-33)34-26-18-11-19-27-34/h8-27,30,35-37H,28-29H2,1-7H3/t30-,35+,36-,37-/m1/s1 |
| InChIKey | QYDYJODSPPFSPB-ZLWKXDTISA-N |
| XLogP | 8.85 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.73 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|