C37H41BO4 — CID 10816696
(4R,5R)-2-[(1R,2S)-2-butylcyclopropyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane (PubChem CID 10816696) has the molecular formula C37H41BO4 and a molecular weight of 560.54 g/mol. Its IUPAC name is (4R,5R)-2-[(1R,2S)-2-butylcyclopropyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-2-[(1R,2S)-2-butylcyclopropyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10816696 |
| Molecular Formula | C37H41BO4 |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | (4R,5R)-2-[(1R,2S)-2-butylcyclopropyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane |
| SMILES | CCCC[C@H]1C[C@H]1B1O[C@@H](C(OC)(c2ccccc2)c2ccccc2)[C@H](C(OC)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C37H41BO4/c1-4-5-18-28-27-33(28)38-41-34(36(39-2,29-19-10-6-11-20-29)30-21-12-7-13-22-30)35(42-38)37(40-3,31-23-14-8-15-24-31)32-25-16-9-17-26-32/h6-17,19-26,28,33-35H,4-5,18,27H2,1-3H3/t28-,33+,34+,35+/m0/s1 |
| InChIKey | DXBBCBGIHVTVNO-MFKFKKEGSA-N |
| XLogP | 8.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|