C46H59BO5Si — CID 46914789
[(1S,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-1-cyclohexylbut-3-enoxy]-tert-butyl-dimethylsilane (PubChem CID 46914789) has the molecular formula C46H59BO5Si and a molecular weight of 730.87 g/mol. Its IUPAC name is [(1S,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-1-cyclohexylbut-3-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-1-cyclohexylbut-3-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 46914789 |
| Molecular Formula | C46H59BO5Si |
| Molecular Weight | 730.87 g/mol |
| Exact Mass | 730.42 |
| IUPAC Name | [(1S,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-1-cyclohexylbut-3-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C=C[C@H](B1O[C@@H](C(OC)(c2ccccc2)c2ccccc2)[C@H](C(OC)(c2ccccc2)c2ccccc2)O1)[C@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C46H59BO5Si/c1-9-40(41(35-25-15-10-16-26-35)52-53(7,8)44(2,3)4)47-50-42(45(48-5,36-27-17-11-18-28-36)37-29-19-12-20-30-37)43(51-47)46(49-6,38-31-21-13-22-32-38)39-33-23-14-24-34-39/h9,11-14,17-24,27-35,40-43H,1,10,15-16,25-26H2,2-8H3/t40-,41+,42+,43+/m0/s1 |
| InChIKey | MTXIQKZCMQLABN-KJZLRKSBSA-N |
| XLogP | 10.97 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.87 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|