C42H43BO5 — CID 102337875
(3S,4R)-4-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-1-phenylhex-5-en-3-ol (PubChem CID 102337875) has the molecular formula C42H43BO5 and a molecular weight of 638.61 g/mol. Its IUPAC name is (3S,4R)-4-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-1-phenylhex-5-en-3-ol.
| Compound Name | (3S,4R)-4-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-1-phenylhex-5-en-3-ol |
|---|---|
| PubChem CID | 102337875 |
| Molecular Formula | C42H43BO5 |
| Molecular Weight | 638.61 g/mol |
| Exact Mass | 638.32 |
| IUPAC Name | (3S,4R)-4-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-1-phenylhex-5-en-3-ol |
| SMILES | C=C[C@@H](B1O[C@@H](C(OC)(c2ccccc2)c2ccccc2)[C@H](C(OC)(c2ccccc2)c2ccccc2)O1)[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C42H43BO5/c1-4-37(38(44)31-30-32-20-10-5-11-21-32)43-47-39(41(45-2,33-22-12-6-13-23-33)34-24-14-7-15-25-34)40(48-43)42(46-3,35-26-16-8-17-27-35)36-28-18-9-19-29-36/h4-29,37-40,44H,1,30-31H2,2-3H3/t37-,38+,39-,40-/m1/s1 |
| InChIKey | ODWDUUHBNZGQHL-KKOUMEGGSA-N |
| XLogP | 7.99 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.61 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|