C35H37BO5 — CID 72735742
(E)-4-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-2-methylbut-3-en-2-ol (PubChem CID 72735742) has the molecular formula C35H37BO5 and a molecular weight of 548.49 g/mol. Its IUPAC name is (E)-4-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-2-methylbut-3-en-2-ol.
| Compound Name | (E)-4-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-2-methylbut-3-en-2-ol |
|---|---|
| PubChem CID | 72735742 |
| Molecular Formula | C35H37BO5 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | (E)-4-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-2-methylbut-3-en-2-ol |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1OB(/C=C/C(C)(C)O)O[C@H]1C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H37BO5/c1-33(2,37)25-26-36-40-31(34(38-3,27-17-9-5-10-18-27)28-19-11-6-12-20-28)32(41-36)35(39-4,29-21-13-7-14-22-29)30-23-15-8-16-24-30/h5-26,31-32,37H,1-4H3/b26-25+/t31-,32-/m1/s1 |
| InChIKey | GYDWYZNJDFPCTL-YWIXOXCVSA-N |
| XLogP | 6.31 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|