C37H41BO5 — CID 102337877
(3S,4R)-4-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-2-methylhex-5-en-3-ol (PubChem CID 102337877) has the molecular formula C37H41BO5 and a molecular weight of 576.54 g/mol. Its IUPAC name is (3S,4R)-4-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-2-methylhex-5-en-3-ol.
| Compound Name | (3S,4R)-4-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-2-methylhex-5-en-3-ol |
|---|---|
| PubChem CID | 102337877 |
| Molecular Formula | C37H41BO5 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | (3S,4R)-4-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-2-methylhex-5-en-3-ol |
| SMILES | C=C[C@@H](B1O[C@@H](C(OC)(c2ccccc2)c2ccccc2)[C@H](C(OC)(c2ccccc2)c2ccccc2)O1)[C@H](O)C(C)C |
| InChI | InChI=1S/C37H41BO5/c1-6-32(33(39)27(2)3)38-42-34(36(40-4,28-19-11-7-12-20-28)29-21-13-8-14-22-29)35(43-38)37(41-5,30-23-15-9-16-24-30)31-25-17-10-18-26-31/h6-27,32-35,39H,1H2,2-5H3/t32-,33-,34-,35-/m1/s1 |
| InChIKey | UDNHPSBCERTOCY-BAQBVXSRSA-N |
| XLogP | 7.01 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|