C39H47BO5Si — CID 134903834
2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]prop-2-enoxy-tert-butyl-dimethylsilane (PubChem CID 134903834) has the molecular formula C39H47BO5Si and a molecular weight of 634.70 g/mol. Its IUPAC name is 2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]prop-2-enoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]prop-2-enoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134903834 |
| Molecular Formula | C39H47BO5Si |
| Molecular Weight | 634.70 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | 2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]prop-2-enoxy-tert-butyl-dimethylsilane |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)B1O[C@@H](C(OC)(c2ccccc2)c2ccccc2)[C@H](C(OC)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C39H47BO5Si/c1-30(29-43-46(7,8)37(2,3)4)40-44-35(38(41-5,31-21-13-9-14-22-31)32-23-15-10-16-24-32)36(45-40)39(42-6,33-25-17-11-18-26-33)34-27-19-12-20-28-34/h9-28,35-36H,1,29H2,2-8H3/t35-,36-/m1/s1 |
| InChIKey | KDKCJJSCXYLHDO-LQFQNGICSA-N |
| XLogP | 8.56 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.70 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|