C49H51BO5Si — CID 134903833
2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]prop-2-enoxy-tert-butyl-diphenylsilane (PubChem CID 134903833) has the molecular formula C49H51BO5Si and a molecular weight of 758.84 g/mol. Its IUPAC name is 2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]prop-2-enoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]prop-2-enoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134903833 |
| Molecular Formula | C49H51BO5Si |
| Molecular Weight | 758.84 g/mol |
| Exact Mass | 758.36 |
| IUPAC Name | 2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]prop-2-enoxy-tert-butyl-diphenylsilane |
| SMILES | C=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)B1O[C@@H](C(OC)(c2ccccc2)c2ccccc2)[C@H](C(OC)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C49H51BO5Si/c1-38(37-53-56(47(2,3)4,43-33-21-11-22-34-43)44-35-23-12-24-36-44)50-54-45(48(51-5,39-25-13-7-14-26-39)40-27-15-8-16-28-40)46(55-50)49(52-6,41-29-17-9-18-30-41)42-31-19-10-20-32-42/h7-36,45-46H,1,37H2,2-6H3/t45-,46-/m1/s1 |
| InChIKey | NJFPTGBZOHVWQI-AWSIMMLFSA-N |
| XLogP | 9.11 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.84 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|