C38H43BO5 — CID 135079626
(E,3R)-1-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]oct-1-en-3-ol (PubChem CID 135079626) has the molecular formula C38H43BO5 and a molecular weight of 590.57 g/mol. Its IUPAC name is (E,3R)-1-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]oct-1-en-3-ol.
| Compound Name | (E,3R)-1-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]oct-1-en-3-ol |
|---|---|
| PubChem CID | 135079626 |
| Molecular Formula | C38H43BO5 |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | (E,3R)-1-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]oct-1-en-3-ol |
| SMILES | CCCCC[C@@H](O)/C=C/B1O[C@@H](C(OC)(c2ccccc2)c2ccccc2)[C@H](C(OC)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C38H43BO5/c1-4-5-10-27-34(40)28-29-39-43-35(37(41-2,30-19-11-6-12-20-30)31-21-13-7-14-22-31)36(44-39)38(42-3,32-23-15-8-16-24-32)33-25-17-9-18-26-33/h6-9,11-26,28-29,34-36,40H,4-5,10,27H2,1-3H3/b29-28+/t34-,35-,36-/m1/s1 |
| InChIKey | GAJDUZYDCGQASR-HTBUBDDWSA-N |
| XLogP | 7.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|