C42H43BO6 — CID 101167257
(1R)-1-[3-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]furan-2-yl]oct-2-yn-1-ol (PubChem CID 101167257) has the molecular formula C42H43BO6 and a molecular weight of 654.61 g/mol. Its IUPAC name is (1R)-1-[3-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]furan-2-yl]oct-2-yn-1-ol.
| Compound Name | (1R)-1-[3-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]furan-2-yl]oct-2-yn-1-ol |
|---|---|
| PubChem CID | 101167257 |
| Molecular Formula | C42H43BO6 |
| Molecular Weight | 654.61 g/mol |
| Exact Mass | 654.32 |
| IUPAC Name | (1R)-1-[3-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]furan-2-yl]oct-2-yn-1-ol |
| SMILES | CCCCCC#C[C@@H](O)c1occc1B1O[C@@H](C(OC)(c2ccccc2)c2ccccc2)[C@H](C(OC)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C42H43BO6/c1-4-5-6-7-20-29-37(44)38-36(30-31-47-38)43-48-39(41(45-2,32-21-12-8-13-22-32)33-23-14-9-15-24-33)40(49-43)42(46-3,34-25-16-10-17-26-34)35-27-18-11-19-28-35/h8-19,21-28,30-31,37,39-40,44H,4-7H2,1-3H3/t37-,39-,40-/m1/s1 |
| InChIKey | JATJVAXYYGZOPS-KHZCBIAOSA-N |
| XLogP | 7.56 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.61 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|