C43H45BO9 — CID 11028944
ethyl (3R)-3-acetyloxy-3-[3-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]furan-2-yl]-2,2-dimethylpropanoate (PubChem CID 11028944) has the molecular formula C43H45BO9 and a molecular weight of 716.64 g/mol. Its IUPAC name is ethyl (3R)-3-acetyloxy-3-[3-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]furan-2-yl]-2,2-dimethylpropanoate.
| Compound Name | ethyl (3R)-3-acetyloxy-3-[3-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]furan-2-yl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11028944 |
| Molecular Formula | C43H45BO9 |
| Molecular Weight | 716.64 g/mol |
| Exact Mass | 716.32 |
| IUPAC Name | ethyl (3R)-3-acetyloxy-3-[3-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]furan-2-yl]-2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(C)(C)[C@@H](OC(C)=O)c1occc1B1O[C@@H](C(OC)(c2ccccc2)c2ccccc2)[C@H](C(OC)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C43H45BO9/c1-7-49-40(46)41(3,4)37(51-30(2)45)36-35(28-29-50-36)44-52-38(42(47-5,31-20-12-8-13-21-31)32-22-14-9-15-23-32)39(53-44)43(48-6,33-24-16-10-17-25-33)34-26-18-11-19-27-34/h8-29,37-39H,7H2,1-6H3/t37-,38+,39+/m0/s1 |
| InChIKey | SJTQDLLWRPGTHK-LCKTVPPXSA-N |
| XLogP | 7.13 |
| TPSA | 102.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.64 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|