C41H39BO6 — CID 44606724
[(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]methyl benzoate (PubChem CID 44606724) has the molecular formula C41H39BO6 and a molecular weight of 638.57 g/mol. Its IUPAC name is [(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]methyl benzoate.
| Compound Name | [(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]methyl benzoate |
|---|---|
| PubChem CID | 44606724 |
| Molecular Formula | C41H39BO6 |
| Molecular Weight | 638.57 g/mol |
| Exact Mass | 638.28 |
| IUPAC Name | [(1R,2S)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]cyclopropyl]methyl benzoate |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1OB([C@H]2C[C@H]2COC(=O)c2ccccc2)O[C@H]1C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H39BO6/c1-44-40(32-20-10-4-11-21-32,33-22-12-5-13-23-33)37-38(41(45-2,34-24-14-6-15-25-34)35-26-16-7-17-27-35)48-42(47-37)36-28-31(36)29-46-39(43)30-18-8-3-9-19-30/h3-27,31,36-38H,28-29H2,1-2H3/t31-,36-,37+,38+/m0/s1 |
| InChIKey | QIRAMNRWHGVCHC-TWRCKGBRSA-N |
| XLogP | 7.69 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.57 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|