C41H42BNO5 — CID 44606566
trans-(1R,2R)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-N-[(4-methoxyphenyl)methyl]cyclopropan-1-amine (PubChem CID 44606566) has the molecular formula C41H42BNO5 and a molecular weight of 639.60 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-N-[(4-methoxyphenyl)methyl]cyclopropan-1-amine.
| Compound Name | trans-(1R,2R)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-N-[(4-methoxyphenyl)methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 44606566 |
| Molecular Formula | C41H42BNO5 |
| Molecular Weight | 639.60 g/mol |
| Exact Mass | 639.32 |
| IUPAC Name | trans-(1R,2R)-2-[(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolan-2-yl]-N-[(4-methoxyphenyl)methyl]cyclopropan-1-amine |
| SMILES | COc1ccc(CN[C@@H]2C[C@H]2B2O[C@@H](C(OC)(c3ccccc3)c3ccccc3)[C@H](C(OC)(c3ccccc3)c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C41H42BNO5/c1-44-35-26-24-30(25-27-35)29-43-37-28-36(37)42-47-38(40(45-2,31-16-8-4-9-17-31)32-18-10-5-11-19-32)39(48-42)41(46-3,33-20-12-6-13-21-33)34-22-14-7-15-23-34/h4-27,36-39,43H,28-29H2,1-3H3/t36-,37-,38-,39-/m1/s1 |
| InChIKey | WLTAOARIXXCKOA-WRCAVZGJSA-N |
| XLogP | 7.38 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.60 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|