C22H46OSn — CID 10928397
tributyl(1-octoxyethenyl)stannane (PubChem CID 10928397) has the molecular formula C22H46OSn and a molecular weight of 445.32 g/mol. Its IUPAC name is tributyl(1-octoxyethenyl)stannane.
| Compound Name | tributyl(1-octoxyethenyl)stannane |
|---|---|
| PubChem CID | 10928397 |
| Molecular Formula | C22H46OSn |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | tributyl(1-octoxyethenyl)stannane |
| SMILES | C=C(OCCCCCCCC)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C10H19O.3C4H9.Sn/c1-3-5-6-7-8-9-10-11-4-2;3*1-3-4-2;/h2-3,5-10H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | SEQZGFDUFRQUNQ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|