C26H31NO6S — CID 10929009
N-(2,2-dimethoxyethyl)-N-[(3,4-dimethoxyphenyl)-phenylmethyl]-1-phenylmethanesulfonamide (PubChem CID 10929009) has the molecular formula C26H31NO6S and a molecular weight of 485.60 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-[(3,4-dimethoxyphenyl)-phenylmethyl]-1-phenylmethanesulfonamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-[(3,4-dimethoxyphenyl)-phenylmethyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 10929009 |
| Molecular Formula | C26H31NO6S |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-[(3,4-dimethoxyphenyl)-phenylmethyl]-1-phenylmethanesulfonamide |
| SMILES | COc1ccc(C(c2ccccc2)N(CC(OC)OC)S(=O)(=O)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C26H31NO6S/c1-30-23-16-15-22(17-24(23)31-2)26(21-13-9-6-10-14-21)27(18-25(32-3)33-4)34(28,29)19-20-11-7-5-8-12-20/h5-17,25-26H,18-19H2,1-4H3 |
| InChIKey | TYZMSBLUPGNMEO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|