C22H18N2O4 — CID 1092904
N-(4-benzamido-3-methylphenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 1092904) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-(4-benzamido-3-methylphenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(4-benzamido-3-methylphenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 1092904 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-(4-benzamido-3-methylphenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc3c(c2)OCO3)ccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O4/c1-14-11-17(8-9-18(14)24-21(25)15-5-3-2-4-6-15)23-22(26)16-7-10-19-20(12-16)28-13-27-19/h2-12H,13H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | XULWUJNRHNYSSD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |