C16H16Cl2N4O — CID 109295997
N-[2-(2,4-dichlorophenyl)ethyl]-2-(prop-2-enylamino)pyrimidine-4-carboxamide (PubChem CID 109295997) has the molecular formula C16H16Cl2N4O and a molecular weight of 351.24 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-(prop-2-enylamino)pyrimidine-4-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(prop-2-enylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109295997 |
| Molecular Formula | C16H16Cl2N4O |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(prop-2-enylamino)pyrimidine-4-carboxamide |
| SMILES | C=CCNc1nccc(C(=O)NCCc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C16H16Cl2N4O/c1-2-7-20-16-21-9-6-14(22-16)15(23)19-8-5-11-3-4-12(17)10-13(11)18/h2-4,6,9-10H,1,5,7-8H2,(H,19,23)(H,20,21,22) |
| InChIKey | PZKHPGZJOLPHLX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|