C27H34N2O11 — CID 10929779
2-[[3-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)piperidin-1-ium-1-yl]methyl]phenol;bis(2-hydroxy-2-oxoacetate) (PubChem CID 10929779) has the molecular formula C27H34N2O11 and a molecular weight of 562.57 g/mol. Its IUPAC name is 2-[[3-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)piperidin-1-ium-1-yl]methyl]phenol;bis(2-hydroxy-2-oxoacetate).
| Compound Name | 2-[[3-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)piperidin-1-ium-1-yl]methyl]phenol;bis(2-hydroxy-2-oxoacetate) |
|---|---|
| PubChem CID | 10929779 |
| Molecular Formula | C27H34N2O11 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 2-[[3-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)piperidin-1-ium-1-yl]methyl]phenol;bis(2-hydroxy-2-oxoacetate) |
| SMILES | COc1cc2c(cc1OC)C[NH+](C1CCC[NH+](Cc3ccccc3O)C1)CC2.O=C([O-])C(=O)O.O=C([O-])C(=O)O |
| InChI | InChI=1S/C23H30N2O3.2C2H2O4/c1-27-22-12-17-9-11-25(15-19(17)13-23(22)28-2)20-7-5-10-24(16-20)14-18-6-3-4-8-21(18)26;2*3-1(4)2(5)6/h3-4,6,8,12-13,20,26H,5,7,9-11,14-16H2,1-2H3;2*(H,3,4)(H,5,6) |
| InChIKey | AZGWKGMPOXTCFI-UHFFFAOYSA-N |
| XLogP | -3.76 |
| TPSA | 202.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|