C34H66O5Si2 — CID 10930122
(3S,4S,5E)-7-[(2R,3R,4S,6S,8R,10S)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-2-propan-2-yl-1,7-dioxaspiro[5.5]undecan-8-yl]-3,5-dimethylhepta-1,5-dien-4-ol (PubChem CID 10930122) has the molecular formula C34H66O5Si2 and a molecular weight of 611.07 g/mol. Its IUPAC name is (3S,4S,5E)-7-[(2R,3R,4S,6S,8R,10S)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-2-propan-2-yl-1,7-dioxaspiro[5.5]undecan-8-yl]-3,5-dimethylhepta-1,5-dien-4-ol.
| Compound Name | (3S,4S,5E)-7-[(2R,3R,4S,6S,8R,10S)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-2-propan-2-yl-1,7-dioxaspiro[5.5]undecan-8-yl]-3,5-dimethylhepta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 10930122 |
| Molecular Formula | C34H66O5Si2 |
| Molecular Weight | 611.07 g/mol |
| Exact Mass | 610.44 |
| IUPAC Name | (3S,4S,5E)-7-[(2R,3R,4S,6S,8R,10S)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-2-propan-2-yl-1,7-dioxaspiro[5.5]undecan-8-yl]-3,5-dimethylhepta-1,5-dien-4-ol |
| SMILES | C=C[C@H](C)[C@H](O)/C(C)=C/C[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@]2(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C(C)C)O2)O1 |
| InChI | InChI=1S/C34H66O5Si2/c1-17-24(4)30(35)25(5)18-19-27-20-28(38-40(13,14)32(7,8)9)21-34(36-27)22-29(26(6)31(37-34)23(2)3)39-41(15,16)33(10,11)12/h17-18,23-24,26-31,35H,1,19-22H2,2-16H3/b25-18+/t24-,26-,27+,28-,29-,30-,31+,34-/m0/s1 |
| InChIKey | BQBNKLHPKJHKSG-ZVEZFDAVSA-N |
| XLogP | 9.24 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.07 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|