C20H36O4 — CID 134974664
(E,2S,3R,4S)-3-methoxy-2,4-dimethyl-6-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]hept-5-en-1-ol (PubChem CID 134974664) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is (E,2S,3R,4S)-3-methoxy-2,4-dimethyl-6-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]hept-5-en-1-ol.
| Compound Name | (E,2S,3R,4S)-3-methoxy-2,4-dimethyl-6-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]hept-5-en-1-ol |
|---|---|
| PubChem CID | 134974664 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | (E,2S,3R,4S)-3-methoxy-2,4-dimethyl-6-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]hept-5-en-1-ol |
| SMILES | CO[C@H]([C@@H](C)/C=C(\C)[C@H]1O[C@@]2(CCCCO2)CC[C@H]1C)[C@@H](C)CO |
| InChI | InChI=1S/C20H36O4/c1-14-8-10-20(9-6-7-11-23-20)24-19(14)16(3)12-15(2)18(22-5)17(4)13-21/h12,14-15,17-19,21H,6-11,13H2,1-5H3/b16-12+/t14-,15+,17+,18-,19+,20+/m1/s1 |
| InChIKey | PTVZDUJAUOSDGE-YHGVCELGSA-N |
| XLogP | 3.92 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|