C22H21NO — CID 10935970
(3R,5S)-2-benzyl-3,5-diphenyl-1,2-oxazolidine (PubChem CID 10935970) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is (3R,5S)-2-benzyl-3,5-diphenyl-1,2-oxazolidine.
| Compound Name | (3R,5S)-2-benzyl-3,5-diphenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 10935970 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (3R,5S)-2-benzyl-3,5-diphenyl-1,2-oxazolidine |
| SMILES | c1ccc(CN2O[C@H](c3ccccc3)C[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21NO/c1-4-10-18(11-5-1)17-23-21(19-12-6-2-7-13-19)16-22(24-23)20-14-8-3-9-15-20/h1-15,21-22H,16-17H2/t21-,22+/m1/s1 |
| InChIKey | WXPIXSQXEIZFLS-YADHBBJMSA-N |
| XLogP | 5.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |