C17H17ClN4O2 — CID 10936876
8-[(E)-2-(3-chlorophenyl)ethenyl]-3-methyl-1-propyl-7H-purine-2,6-dione (PubChem CID 10936876) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is 8-[(E)-2-(3-chlorophenyl)ethenyl]-3-methyl-1-propyl-7H-purine-2,6-dione.
| Compound Name | 8-[(E)-2-(3-chlorophenyl)ethenyl]-3-methyl-1-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 10936876 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 8-[(E)-2-(3-chlorophenyl)ethenyl]-3-methyl-1-propyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(/C=C/c3cccc(Cl)c3)nc2n(C)c1=O |
| InChI | InChI=1S/C17H17ClN4O2/c1-3-9-22-16(23)14-15(21(2)17(22)24)20-13(19-14)8-7-11-5-4-6-12(18)10-11/h4-8,10H,3,9H2,1-2H3,(H,19,20)/b8-7+ |
| InChIKey | UUFGUKMXVDXPEO-BQYQJAHWSA-N |
| XLogP | 2.66 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |